C29H35NO2Si — CID 134866999
(6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidin-2-one (PubChem CID 134866999) has the molecular formula C29H35NO2Si and a molecular weight of 457.69 g/mol. Its IUPAC name is (6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidin-2-one.
| Compound Name | (6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidin-2-one |
|---|---|
| PubChem CID | 134866999 |
| Molecular Formula | C29H35NO2Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (6R)-6-[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-phenylethyl]piperidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H](c1ccccc1)[C@H]1CCCC(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO2Si/c1-29(2,3)33(24-16-9-5-10-17-24,25-18-11-6-12-19-25)32-22-26(23-14-7-4-8-15-23)27-20-13-21-28(31)30-27/h4-12,14-19,26-27H,13,20-22H2,1-3H3,(H,30,31)/t26-,27-/m1/s1 |
| InChIKey | WZUVPHKWXBNFAM-KAYWLYCHSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|