C26H35NO2Si — CID 45103028
(5S)-5-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]pyrrolidin-2-one (PubChem CID 45103028) has the molecular formula C26H35NO2Si and a molecular weight of 421.66 g/mol. Its IUPAC name is (5S)-5-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 45103028 |
| Molecular Formula | C26H35NO2Si |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (5S)-5-[(Z)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-enyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCCC/C=C\[C@@H]1CCC(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35NO2Si/c1-26(2,3)30(23-15-9-6-10-16-23,24-17-11-7-12-18-24)29-21-13-5-4-8-14-22-19-20-25(28)27-22/h6-12,14-18,22H,4-5,13,19-21H2,1-3H3,(H,27,28)/b14-8-/t22-/m1/s1 |
| InChIKey | DYMWQOSMCVZAME-VRVLXJBKSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|