C21H27NO2Si — CID 58011546
5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one (PubChem CID 58011546) has the molecular formula C21H27NO2Si and a molecular weight of 353.54 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 58011546 |
| Molecular Formula | C21H27NO2Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OCC1CCC(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2Si/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)24-16-17-14-15-20(23)22-17/h4-13,17H,14-16H2,1-3H3,(H,22,23) |
| InChIKey | GVPMKPSKHXFYOR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|