C22H29NO2Si — CID 11824748
tert-butyl-[[(2R)-5-methoxy-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane (PubChem CID 11824748) has the molecular formula C22H29NO2Si and a molecular weight of 367.57 g/mol. Its IUPAC name is tert-butyl-[[(2R)-5-methoxy-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R)-5-methoxy-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11824748 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | tert-butyl-[[(2R)-5-methoxy-3,4-dihydro-2H-pyrrol-2-yl]methoxy]-diphenylsilane |
| SMILES | COC1=N[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H29NO2Si/c1-22(2,3)26(19-11-7-5-8-12-19,20-13-9-6-10-14-20)25-17-18-15-16-21(23-18)24-4/h5-14,18H,15-17H2,1-4H3/t18-/m1/s1 |
| InChIKey | QIRHXDUXQXOLPB-GOSISDBHSA-N |
| XLogP | 3.77 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|