C29H40OSi — CID 175936274
tert-butyl-[(4-cyclohexylidenecyclohexyl)methoxy]-diphenylsilane (PubChem CID 175936274) has the molecular formula C29H40OSi and a molecular weight of 432.72 g/mol. Its IUPAC name is tert-butyl-[(4-cyclohexylidenecyclohexyl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4-cyclohexylidenecyclohexyl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 175936274 |
| Molecular Formula | C29H40OSi |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | tert-butyl-[(4-cyclohexylidenecyclohexyl)methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC1CCC(=C2CCCCC2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H40OSi/c1-29(2,3)31(27-15-9-5-10-16-27,28-17-11-6-12-18-28)30-23-24-19-21-26(22-20-24)25-13-7-4-8-14-25/h5-6,9-12,15-18,24H,4,7-8,13-14,19-23H2,1-3H3 |
| InChIKey | LZXNTBMJFNVRAA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|