C25H34OSi — CID 156858499
tert-butyl-[(4-ethenylcyclohexyl)methoxy]-diphenylsilane (PubChem CID 156858499) has the molecular formula C25H34OSi and a molecular weight of 378.63 g/mol. Its IUPAC name is tert-butyl-[(4-ethenylcyclohexyl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4-ethenylcyclohexyl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 156858499 |
| Molecular Formula | C25H34OSi |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | tert-butyl-[(4-ethenylcyclohexyl)methoxy]-diphenylsilane |
| SMILES | C=CC1CCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H34OSi/c1-5-21-16-18-22(19-17-21)20-26-27(25(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h5-15,21-22H,1,16-20H2,2-4H3 |
| InChIKey | VOMQKFGKEBWKRR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|