C23H30O2Si — CID 101065622
trans-(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylidenecyclopentan-1-ol (PubChem CID 101065622) has the molecular formula C23H30O2Si and a molecular weight of 366.58 g/mol. Its IUPAC name is trans-(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylidenecyclopentan-1-ol.
| Compound Name | trans-(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 101065622 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | trans-(1R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylidenecyclopentan-1-ol |
| SMILES | C=C1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@H]1O |
| InChI | InChI=1S/C23H30O2Si/c1-18-19(15-16-22(18)24)17-25-26(23(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22,24H,1,15-17H2,2-4H3/t19-,22-/m1/s1 |
| InChIKey | LWEBFMBXMLJPBJ-DENIHFKCSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|