C24H34O2Si — CID 66761813
4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylcyclohexan-1-ol (PubChem CID 66761813) has the molecular formula C24H34O2Si and a molecular weight of 382.62 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylcyclohexan-1-ol.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 66761813 |
| Molecular Formula | C24H34O2Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylcyclohexan-1-ol |
| SMILES | CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC(O)CC1 |
| InChI | InChI=1S/C24H34O2Si/c1-23(2,3)27(21-11-7-5-8-12-21,22-13-9-6-10-14-22)26-19-24(4)17-15-20(25)16-18-24/h5-14,20,25H,15-19H2,1-4H3 |
| InChIKey | ZPTFIILLAJTKSS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|