C29H43NO4Si — CID 70871740
tert-butyl-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxycyclohexyl]carbamic acid (PubChem CID 70871740) has the molecular formula C29H43NO4Si and a molecular weight of 497.75 g/mol. Its IUPAC name is tert-butyl-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxycyclohexyl]carbamic acid.
| Compound Name | tert-butyl-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxycyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 70871740 |
| Molecular Formula | C29H43NO4Si |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | tert-butyl-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxycyclohexyl]carbamic acid |
| SMILES | COC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC(N(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C29H43NO4Si/c1-27(2,3)30(26(31)32)23-18-20-29(33-7,21-19-23)22-34-35(28(4,5)6,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,23H,18-22H2,1-7H3,(H,31,32) |
| InChIKey | LKPUQKQYLAPWLG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|