C26H32O3Si — CID 135075131
1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dimethylcyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 135075131) has the molecular formula C26H32O3Si and a molecular weight of 420.63 g/mol. Its IUPAC name is 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dimethylcyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dimethylcyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 135075131 |
| Molecular Formula | C26H32O3Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 1-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,5-dimethylcyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CC1=CC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(C(=O)O)C=C(C)C1 |
| InChI | InChI=1S/C26H32O3Si/c1-20-16-21(2)18-26(17-20,24(27)28)19-29-30(25(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,17-18H,16,19H2,1-5H3,(H,27,28) |
| InChIKey | LCHCKMKXIHZORR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|