C28H36O3Si — CID 160957767
(E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid (PubChem CID 160957767) has the molecular formula C28H36O3Si and a molecular weight of 448.68 g/mol. Its IUPAC name is (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 160957767 |
| Molecular Formula | C28H36O3Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoic acid |
| SMILES | CC(C)(C)[Si](OCC12CCC(/C=C/C(=O)O)(CC1)CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36O3Si/c1-26(2,3)32(23-10-6-4-7-11-23,24-12-8-5-9-13-24)31-22-28-19-16-27(17-20-28,18-21-28)15-14-25(29)30/h4-15H,16-22H2,1-3H3,(H,29,30)/b15-14+ |
| InChIKey | SWPPSEJXCIFERI-CCEZHUSRSA-N |
| XLogP | 5.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|