C26H36O4Si — CID 159943416
1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropane-1-carbaldehyde;[1-(hydroxymethyl)cyclopropyl]methanol (PubChem CID 159943416) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is 1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropane-1-carbaldehyde;[1-(hydroxymethyl)cyclopropyl]methanol.
| Compound Name | 1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropane-1-carbaldehyde;[1-(hydroxymethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 159943416 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropane-1-carbaldehyde;[1-(hydroxymethyl)cyclopropyl]methanol |
| SMILES | CC(C)(C)[Si](OCC1(C=O)CC1)(c1ccccc1)c1ccccc1.OCC1(CO)CC1 |
| InChI | InChI=1S/C21H26O2Si.C5H10O2/c1-20(2,3)24(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-17-21(16-22)14-15-21;6-3-5(4-7)1-2-5/h4-13,16H,14-15,17H2,1-3H3;6-7H,1-4H2 |
| InChIKey | OBEHZCKKLSKUDQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|