C29H35NO3Si — CID 68527039
benzyl N-[[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methyl]carbamate (PubChem CID 68527039) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is benzyl N-[[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methyl]carbamate.
| Compound Name | benzyl N-[[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methyl]carbamate |
|---|---|
| PubChem CID | 68527039 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | benzyl N-[[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methyl]carbamate |
| SMILES | CC(C)(C)[Si](OCC1(CNC(=O)OCc2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO3Si/c1-28(2,3)34(25-15-9-5-10-16-25,26-17-11-6-12-18-26)33-23-29(19-20-29)22-30-27(31)32-21-24-13-7-4-8-14-24/h4-18H,19-23H2,1-3H3,(H,30,31) |
| InChIKey | RJEMEINRPZSNDG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|