C35H42O3Si — CID 142527042
benzyl (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoate (PubChem CID 142527042) has the molecular formula C35H42O3Si and a molecular weight of 538.80 g/mol. Its IUPAC name is benzyl (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoate.
| Compound Name | benzyl (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoate |
|---|---|
| PubChem CID | 142527042 |
| Molecular Formula | C35H42O3Si |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | benzyl (E)-3-[4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-bicyclo[2.2.2]octanyl]prop-2-enoate |
| SMILES | CC(C)(C)[Si](OCC12CCC(/C=C/C(=O)OCc3ccccc3)(CC1)CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H42O3Si/c1-33(2,3)39(30-15-9-5-10-16-30,31-17-11-6-12-18-31)38-28-35-24-21-34(22-25-35,23-26-35)20-19-32(36)37-27-29-13-7-4-8-14-29/h4-20H,21-28H2,1-3H3/b20-19+ |
| InChIKey | NESOWZMKWIBLGY-FMQUCBEESA-N |
| XLogP | 7.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|