C22H28OSi — CID 142733105
1-bicyclo[1.1.1]pentanylmethoxy-tert-butyl-diphenylsilane (PubChem CID 142733105) has the molecular formula C22H28OSi and a molecular weight of 336.55 g/mol. Its IUPAC name is 1-bicyclo[1.1.1]pentanylmethoxy-tert-butyl-diphenylsilane.
| Compound Name | 1-bicyclo[1.1.1]pentanylmethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 142733105 |
| Molecular Formula | C22H28OSi |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-bicyclo[1.1.1]pentanylmethoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC12CC(C1)C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28OSi/c1-21(2,3)24(19-10-6-4-7-11-19,20-12-8-5-9-13-20)23-17-22-14-18(15-22)16-22/h4-13,18H,14-17H2,1-3H3 |
| InChIKey | AWDHAWNKIGEVIW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|