C23H29FO3Si — CID 174055534
ethyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-fluorocyclopropane-1-carboxylate (PubChem CID 174055534) has the molecular formula C23H29FO3Si and a molecular weight of 400.57 g/mol. Its IUPAC name is ethyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-fluorocyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-fluorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 174055534 |
| Molecular Formula | C23H29FO3Si |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-fluorocyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1(F)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29FO3Si/c1-5-26-21(25)20-16-23(20,24)17-27-28(22(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20H,5,16-17H2,1-4H3 |
| InChIKey | UDHYVCLQHNRFQG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|