C26H33BrO4Si — CID 155592367
ethyl 3-bromo-4-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-oxobutanoate (PubChem CID 155592367) has the molecular formula C26H33BrO4Si and a molecular weight of 517.54 g/mol. Its IUPAC name is ethyl 3-bromo-4-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-oxobutanoate.
| Compound Name | ethyl 3-bromo-4-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-oxobutanoate |
|---|---|
| PubChem CID | 155592367 |
| Molecular Formula | C26H33BrO4Si |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | ethyl 3-bromo-4-[1-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-oxobutanoate |
| SMILES | CCOC(=O)C(=O)C(Br)CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H33BrO4Si/c1-5-30-24(29)23(28)22(27)18-26(16-17-26)19-31-32(25(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,22H,5,16-19H2,1-4H3 |
| InChIKey | XGLADBJPQIUKIV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|