C30H42O5Si — CID 51039490
ethyl (E)-4-[(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxan-2-yl]-2-methylbut-2-enoate (PubChem CID 51039490) has the molecular formula C30H42O5Si and a molecular weight of 510.75 g/mol. Its IUPAC name is ethyl (E)-4-[(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxan-2-yl]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxan-2-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 51039490 |
| Molecular Formula | C30H42O5Si |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | ethyl (E)-4-[(2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-3-methyloxan-2-yl]-2-methylbut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@]1(C)O |
| InChI | InChI=1S/C30H42O5Si/c1-7-33-28(31)23(2)18-19-27-30(6,32)21-20-24(35-27)22-34-36(29(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-18,24,27,32H,7,19-22H2,1-6H3/b23-18+/t24-,27-,30+/m0/s1 |
| InChIKey | SABUQYSXDNSPIJ-IYYGVYDXSA-N |
| XLogP | 4.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|