C23H29IO2Si — CID 57408148
tert-butyl-[[(2S,5S)-5-[(Z)-2-iodoethenyl]oxolan-2-yl]methoxy]-diphenylsilane (PubChem CID 57408148) has the molecular formula C23H29IO2Si and a molecular weight of 492.47 g/mol. Its IUPAC name is tert-butyl-[[(2S,5S)-5-[(Z)-2-iodoethenyl]oxolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,5S)-5-[(Z)-2-iodoethenyl]oxolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 57408148 |
| Molecular Formula | C23H29IO2Si |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | tert-butyl-[[(2S,5S)-5-[(Z)-2-iodoethenyl]oxolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H](/C=C\I)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29IO2Si/c1-23(2,3)27(21-10-6-4-7-11-21,22-12-8-5-9-13-22)25-18-20-15-14-19(26-20)16-17-24/h4-13,16-17,19-20H,14-15,18H2,1-3H3/b17-16-/t19-,20-/m0/s1 |
| InChIKey | XVLNNUDMCMUQDI-YZASKEDZSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|