C22H31NO2Si — CID 142544481
(3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-amine (PubChem CID 142544481) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is (3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-amine.
| Compound Name | (3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-amine |
|---|---|
| PubChem CID | 142544481 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-amine |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H](N)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31NO2Si/c1-22(2,3)26(20-10-6-4-7-11-20,21-12-8-5-9-13-21)25-17-19-15-14-18(23)16-24-19/h4-13,18-19H,14-17,23H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | XTQXLWAAWHNWOB-MOPGFXCFSA-N |
| XLogP | 3.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|