C23H30N2O2Si — CID 66588772
(3R,6S)-3-amino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carbonitrile (PubChem CID 66588772) has the molecular formula C23H30N2O2Si and a molecular weight of 394.59 g/mol. Its IUPAC name is (3R,6S)-3-amino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carbonitrile.
| Compound Name | (3R,6S)-3-amino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carbonitrile |
|---|---|
| PubChem CID | 66588772 |
| Molecular Formula | C23H30N2O2Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (3R,6S)-3-amino-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxane-3-carbonitrile |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@](N)(C#N)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O2Si/c1-22(2,3)28(20-10-6-4-7-11-20,21-12-8-5-9-13-21)27-16-19-14-15-23(25,17-24)18-26-19/h4-13,19H,14-16,18,25H2,1-3H3/t19-,23+/m0/s1 |
| InChIKey | LBYCUIAYXMKKEZ-WMZHIEFXSA-N |
| XLogP | 2.96 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|