C22H28N2OSi — CID 169182525
1-[1-amino-2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopropane-1-carbonitrile (PubChem CID 169182525) has the molecular formula C22H28N2OSi and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-[1-amino-2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[1-amino-2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 169182525 |
| Molecular Formula | C22H28N2OSi |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[1-amino-2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopropane-1-carbonitrile |
| SMILES | CC(C)(C)[Si](OCC(N)C1(C#N)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2OSi/c1-21(2,3)26(18-10-6-4-7-11-18,19-12-8-5-9-13-19)25-16-20(24)22(17-23)14-15-22/h4-13,20H,14-16,24H2,1-3H3 |
| InChIKey | IIHCGWJKFMXOKU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|