C21H29NO2Si — CID 169182431
2-[tert-butyl(diphenyl)silyl]oxy-1-(oxetan-3-yl)ethanamine (PubChem CID 169182431) has the molecular formula C21H29NO2Si and a molecular weight of 355.55 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-1-(oxetan-3-yl)ethanamine.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-(oxetan-3-yl)ethanamine |
|---|---|
| PubChem CID | 169182431 |
| Molecular Formula | C21H29NO2Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-1-(oxetan-3-yl)ethanamine |
| SMILES | CC(C)(C)[Si](OCC(N)C1COC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO2Si/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)24-16-20(22)17-14-23-15-17/h4-13,17,20H,14-16,22H2,1-3H3 |
| InChIKey | HOOUJVMZVJBZQZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|