C40H52O4Si2 — CID 10439261
tert-butyl-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dioxolan-2-yl)butoxy]-diphenylsilane (PubChem CID 10439261) has the molecular formula C40H52O4Si2 and a molecular weight of 653.02 g/mol. Its IUPAC name is tert-butyl-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dioxolan-2-yl)butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dioxolan-2-yl)butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10439261 |
| Molecular Formula | C40H52O4Si2 |
| Molecular Weight | 653.02 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | tert-butyl-[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dioxolan-2-yl)butoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC(CCC1OCCO1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H52O4Si2/c1-39(2,3)45(34-19-11-7-12-20-34,35-21-13-8-14-22-35)43-31-33(27-28-38-41-29-30-42-38)32-44-46(40(4,5)6,36-23-15-9-16-24-36)37-25-17-10-18-26-37/h7-26,33,38H,27-32H2,1-6H3 |
| InChIKey | LCKSVXWLIASNJP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.02 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|