C19H26O2SSi — CID 15451317
(2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-sulfanylpropan-2-ol (PubChem CID 15451317) has the molecular formula C19H26O2SSi and a molecular weight of 346.57 g/mol. Its IUPAC name is (2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-sulfanylpropan-2-ol.
| Compound Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 15451317 |
| Molecular Formula | C19H26O2SSi |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-3-sulfanylpropan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)CS)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26O2SSi/c1-19(2,3)23(21-14-16(20)15-22,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,20,22H,14-15H2,1-3H3/t16-/m1/s1 |
| InChIKey | FMOJSIMEQAVCSV-MRXNPFEDSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|