C21H28O4Si — CID 11749095
methyl (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybutanoate (PubChem CID 11749095) has the molecular formula C21H28O4Si and a molecular weight of 372.54 g/mol. Its IUPAC name is methyl (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybutanoate.
| Compound Name | methyl (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybutanoate |
|---|---|
| PubChem CID | 11749095 |
| Molecular Formula | C21H28O4Si |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl (3S)-4-[tert-butyl(diphenyl)silyl]oxy-3-hydroxybutanoate |
| SMILES | COC(=O)C[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H28O4Si/c1-21(2,3)26(18-11-7-5-8-12-18,19-13-9-6-10-14-19)25-16-17(22)15-20(23)24-4/h5-14,17,22H,15-16H2,1-4H3/t17-/m0/s1 |
| InChIKey | IYARNAWKJBPAJQ-KRWDZBQOSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|