C25H36O3Si — CID 11037048
(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxynonan-4-one (PubChem CID 11037048) has the molecular formula C25H36O3Si and a molecular weight of 412.65 g/mol. Its IUPAC name is (2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxynonan-4-one.
| Compound Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxynonan-4-one |
|---|---|
| PubChem CID | 11037048 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-hydroxynonan-4-one |
| SMILES | CCCCCC(=O)C[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O3Si/c1-5-6-9-14-21(26)19-22(27)20-28-29(25(2,3)4,23-15-10-7-11-16-23)24-17-12-8-13-18-24/h7-8,10-13,15-18,22,27H,5-6,9,14,19-20H2,1-4H3/t22-/m1/s1 |
| InChIKey | FEUVJHFXYMIFLD-JOCHJYFZSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|