C41H54O3Si2 — CID 142754739
8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]octan-2-one (PubChem CID 142754739) has the molecular formula C41H54O3Si2 and a molecular weight of 651.05 g/mol. Its IUPAC name is 8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]octan-2-one.
| Compound Name | 8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]octan-2-one |
|---|---|
| PubChem CID | 142754739 |
| Molecular Formula | C41H54O3Si2 |
| Molecular Weight | 651.05 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | 8-[tert-butyl(diphenyl)silyl]oxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]octan-2-one |
| SMILES | CC(=O)CCCCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H54O3Si2/c1-34(42)22-20-21-23-35(32-43-45(40(2,3)4,36-24-12-8-13-25-36)37-26-14-9-15-27-37)33-44-46(41(5,6)7,38-28-16-10-17-29-38)39-30-18-11-19-31-39/h8-19,24-31,35H,20-23,32-33H2,1-7H3 |
| InChIKey | OPZCQKDILYNXAC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.05 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|