C25H28O3Si — CID 168947861
3-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropanoic acid (PubChem CID 168947861) has the molecular formula C25H28O3Si and a molecular weight of 404.58 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropanoic acid.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 168947861 |
| Molecular Formula | C25H28O3Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-2-phenylpropanoic acid |
| SMILES | CC(C)(C)[Si](OCC(C(=O)O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O3Si/c1-25(2,3)29(21-15-9-5-10-16-21,22-17-11-6-12-18-22)28-19-23(24(26)27)20-13-7-4-8-14-20/h4-18,23H,19H2,1-3H3,(H,26,27) |
| InChIKey | WTPYKJAFZOPVFY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|