C34H39O6PSi — CID 135067402
[(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphorylethyl] 2,2-diphenylacetate (PubChem CID 135067402) has the molecular formula C34H39O6PSi and a molecular weight of 602.74 g/mol. Its IUPAC name is [(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphorylethyl] 2,2-diphenylacetate.
| Compound Name | [(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphorylethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 135067402 |
| Molecular Formula | C34H39O6PSi |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [(1R)-2-[tert-butyl(diphenyl)silyl]oxy-1-dimethoxyphosphorylethyl] 2,2-diphenylacetate |
| SMILES | COP(=O)(OC)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H39O6PSi/c1-34(2,3)42(29-22-14-8-15-23-29,30-24-16-9-17-25-30)39-26-31(41(36,37-4)38-5)40-33(35)32(27-18-10-6-11-19-27)28-20-12-7-13-21-28/h6-25,31-32H,26H2,1-5H3/t31-/m1/s1 |
| InChIKey | VZOZRQBNCBKEOB-WJOKGBTCSA-N |
| XLogP | 6.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|