C22H28O4Si — CID 102238795
[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl] methyl carbonate (PubChem CID 102238795) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl] methyl carbonate.
| Compound Name | [(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 102238795 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl] methyl carbonate |
| SMILES | C=C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)OC |
| InChI | InChI=1S/C22H28O4Si/c1-6-18(26-21(23)24-5)17-25-27(22(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h6-16,18H,1,17H2,2-5H3/t18-/m0/s1 |
| InChIKey | CHUPLTGHBIRGCY-SFHVURJKSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|