C12H24O4Si — CID 102073389
[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] methyl carbonate (PubChem CID 102073389) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is [(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] methyl carbonate.
| Compound Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] methyl carbonate |
|---|---|
| PubChem CID | 102073389 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] methyl carbonate |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)OC |
| InChI | InChI=1S/C12H24O4Si/c1-8-10(16-11(13)14-5)9-15-17(6,7)12(2,3)4/h8,10H,1,9H2,2-7H3/t10-/m1/s1 |
| InChIKey | NIMCROWFHUZCQI-SNVBAGLBSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|