C12H26O3Si — CID 76778047
tert-butyl-[2-(methoxymethoxy)but-3-enoxy]-dimethylsilane (PubChem CID 76778047) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is tert-butyl-[2-(methoxymethoxy)but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-(methoxymethoxy)but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 76778047 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | tert-butyl-[2-(methoxymethoxy)but-3-enoxy]-dimethylsilane |
| SMILES | C=CC(CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C12H26O3Si/c1-8-11(14-10-13-5)9-15-16(6,7)12(2,3)4/h8,11H,1,9-10H2,2-7H3 |
| InChIKey | XKTZUHZIWVUECT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|