C24H50O2Si2 — CID 11102001
tert-butyl-[(2S,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-3,4-dimethylhept-6-enoxy]-dimethylsilane (PubChem CID 11102001) has the molecular formula C24H50O2Si2 and a molecular weight of 426.83 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-3,4-dimethylhept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-3,4-dimethylhept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11102001 |
| Molecular Formula | C24H50O2Si2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | tert-butyl-[(2S,3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-ethenyl-3,4-dimethylhept-6-enoxy]-dimethylsilane |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C)[C@@H](C=C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O2Si2/c1-15-21(17-25-27(11,12)23(5,6)7)19(3)20(4)22(16-2)18-26-28(13,14)24(8,9)10/h15-16,19-22H,1-2,17-18H2,3-14H3/t19-,20+,21+,22- |
| InChIKey | GCRVODIPFDJWRT-ZDNVTZCJSA-N |
| XLogP | 7.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|