C19H42OSi — CID 57336860
tert-butyl-dimethyl-[(2S,4S,6S)-2,4,6,8-tetramethylnonoxy]silane (PubChem CID 57336860) has the molecular formula C19H42OSi and a molecular weight of 314.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,4S,6S)-2,4,6,8-tetramethylnonoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2S,4S,6S)-2,4,6,8-tetramethylnonoxy]silane |
|---|---|
| PubChem CID | 57336860 |
| Molecular Formula | C19H42OSi |
| Molecular Weight | 314.63 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,4S,6S)-2,4,6,8-tetramethylnonoxy]silane |
| SMILES | CC(C)C[C@H](C)C[C@H](C)C[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42OSi/c1-15(2)11-16(3)12-17(4)13-18(5)14-20-21(9,10)19(6,7)8/h15-18H,11-14H2,1-10H3/t16-,17-,18-/m0/s1 |
| InChIKey | MRTGMNKIKCIXLY-BZSNNMDCSA-N |
| XLogP | 6.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|