C11H26O4SSi — CID 175551678
[3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl] methanesulfonate (PubChem CID 175551678) has the molecular formula C11H26O4SSi and a molecular weight of 282.48 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl] methanesulfonate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl] methanesulfonate |
|---|---|
| PubChem CID | 175551678 |
| Molecular Formula | C11H26O4SSi |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl] methanesulfonate |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)COS(C)(=O)=O |
| InChI | InChI=1S/C11H26O4SSi/c1-10(8-14-16(5,12)13)9-15-17(6,7)11(2,3)4/h10H,8-9H2,1-7H3 |
| InChIKey | CALFBUVPHQJFTD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|