C12H28O4SSi — CID 10063178
[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]butyl] methanesulfonate (PubChem CID 10063178) has the molecular formula C12H28O4SSi and a molecular weight of 296.51 g/mol. Its IUPAC name is [(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]butyl] methanesulfonate.
| Compound Name | [(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]butyl] methanesulfonate |
|---|---|
| PubChem CID | 10063178 |
| Molecular Formula | C12H28O4SSi |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]butyl] methanesulfonate |
| SMILES | CC[C@H](CO[Si](C)(C)C(C)(C)C)COS(C)(=O)=O |
| InChI | InChI=1S/C12H28O4SSi/c1-8-11(9-15-17(5,13)14)10-16-18(6,7)12(2,3)4/h11H,8-10H2,1-7H3/t11-/m0/s1 |
| InChIKey | UKTVTDZGKSWKTA-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|