C13H28O7S2Si — CID 102424780
[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1-methylsulfonyloxycyclopropyl)ethyl] methanesulfonate (PubChem CID 102424780) has the molecular formula C13H28O7S2Si and a molecular weight of 388.58 g/mol. Its IUPAC name is [(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1-methylsulfonyloxycyclopropyl)ethyl] methanesulfonate.
| Compound Name | [(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1-methylsulfonyloxycyclopropyl)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 102424780 |
| Molecular Formula | C13H28O7S2Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-(1-methylsulfonyloxycyclopropyl)ethyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OS(C)(=O)=O)C1(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H28O7S2Si/c1-12(2,3)23(6,7)18-10-11(19-21(4,14)15)13(8-9-13)20-22(5,16)17/h11H,8-10H2,1-7H3/t11-/m1/s1 |
| InChIKey | POBPQRWUUWMGGU-LLVKDONJSA-N |
| XLogP | 1.86 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|