C12H26O5SSi — CID 123927759
1-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]cyclopropane-1-sulfonic acid (PubChem CID 123927759) has the molecular formula C12H26O5SSi and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]cyclopropane-1-sulfonic acid.
| Compound Name | 1-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]cyclopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123927759 |
| Molecular Formula | C12H26O5SSi |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 1-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]cyclopropane-1-sulfonic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O)CC1(S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C12H26O5SSi/c1-11(2,3)19(4,5)17-9-10(13)8-12(6-7-12)18(14,15)16/h10,13H,6-9H2,1-5H3,(H,14,15,16)/t10-/m1/s1 |
| InChIKey | UCHAMOFGNBIYNT-SNVBAGLBSA-N |
| XLogP | 2.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|