C18H42O6Si2 — CID 11486689
(2R,3R,4R,5R)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,3,4,5-tetrol (PubChem CID 11486689) has the molecular formula C18H42O6Si2 and a molecular weight of 410.70 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 11486689 |
| Molecular Formula | C18H42O6Si2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (2R,3R,4R,5R)-1,6-bis[[tert-butyl(dimethyl)silyl]oxy]hexane-2,3,4,5-tetrol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H42O6Si2/c1-17(2,3)25(7,8)23-11-13(19)15(21)16(22)14(20)12-24-26(9,10)18(4,5)6/h13-16,19-22H,11-12H2,1-10H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | ZIEKCKSFMRPBPQ-KLHDSHLOSA-N |
| XLogP | 2.47 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|