C10H20O2Si — CID 20848710
(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-yn-2-ol (PubChem CID 20848710) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is (2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-yn-2-ol.
| Compound Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-yn-2-ol |
|---|---|
| PubChem CID | 20848710 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-yn-2-ol |
| SMILES | C#C[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H20O2Si/c1-7-9(11)8-12-13(5,6)10(2,3)4/h1,9,11H,8H2,2-6H3/t9-/m0/s1 |
| InChIKey | RSIBPEBNXDSOJQ-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|