C18H38O2Si2 — CID 56850000
tert-butyl-[(2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-ynoxy]-dimethylsilane (PubChem CID 56850000) has the molecular formula C18H38O2Si2 and a molecular weight of 342.67 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 56850000 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | tert-butyl-[(2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-ynoxy]-dimethylsilane |
| SMILES | C#C[C@H](CCO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-12-16(15-20-22(10,11)18(5,6)7)13-14-19-21(8,9)17(2,3)4/h1,16H,13-15H2,2-11H3/t16-/m1/s1 |
| InChIKey | NZOLVFNSXIBTAB-MRXNPFEDSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|