C20H42O2Si2 — CID 11773114
tert-butyl-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-6-ynoxy]-dimethylsilane (PubChem CID 11773114) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-6-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-6-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11773114 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | tert-butyl-[(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylhept-6-ynoxy]-dimethylsilane |
| SMILES | C#CC[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O2Si2/c1-13-14-17(2)18(22-24(11,12)20(6,7)8)15-16-21-23(9,10)19(3,4)5/h1,17-18H,14-16H2,2-12H3/t17-,18+/m1/s1 |
| InChIKey | BBTNALCTQBOUNM-MSOLQXFVSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|