C25H46O2Si2 — CID 177383661
tert-butyl-[(Z,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylhex-5-enoxy]-dimethylsilane (PubChem CID 177383661) has the molecular formula C25H46O2Si2 and a molecular weight of 434.81 g/mol. Its IUPAC name is tert-butyl-[(Z,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylhex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylhex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 177383661 |
| Molecular Formula | C25H46O2Si2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | tert-butyl-[(Z,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-phenylhex-5-enoxy]-dimethylsilane |
| SMILES | C[C@H](/C=C\c1ccccc1)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O2Si2/c1-21(17-18-22-15-13-12-14-16-22)23(27-29(10,11)25(5,6)7)19-20-26-28(8,9)24(2,3)4/h12-18,21,23H,19-20H2,1-11H3/b18-17-/t21-,23+/m1/s1 |
| InChIKey | WAKOURPOHLXZHX-KIGSJDDZSA-N |
| XLogP | 8.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|