C17H26Br2OSi — CID 169094383
tert-butyl-[(E)-2,3-dibromo-5-phenylpent-4-enoxy]-dimethylsilane (PubChem CID 169094383) has the molecular formula C17H26Br2OSi and a molecular weight of 434.29 g/mol. Its IUPAC name is tert-butyl-[(E)-2,3-dibromo-5-phenylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-2,3-dibromo-5-phenylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 169094383 |
| Molecular Formula | C17H26Br2OSi |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | tert-butyl-[(E)-2,3-dibromo-5-phenylpent-4-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(Br)C(Br)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H26Br2OSi/c1-17(2,3)21(4,5)20-13-16(19)15(18)12-11-14-9-7-6-8-10-14/h6-12,15-16H,13H2,1-5H3/b12-11+ |
| InChIKey | RUVGBHFHRMSNAA-VAWYXSNFSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|