C27H39NO2Si — CID 46868612
(2R)-2-[[(1E,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol (PubChem CID 46868612) has the molecular formula C27H39NO2Si and a molecular weight of 437.70 g/mol. Its IUPAC name is (2R)-2-[[(1E,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[(1E,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 46868612 |
| Molecular Formula | C27H39NO2Si |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (2R)-2-[[(1E,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-phenylhexa-1,5-dien-3-yl]amino]-2-phenylethanol |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](/C=C/c1ccccc1)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C27H39NO2Si/c1-7-23(21-30-31(5,6)27(2,3)4)25(19-18-22-14-10-8-11-15-22)28-26(20-29)24-16-12-9-13-17-24/h7-19,23,25-26,28-29H,1,20-21H2,2-6H3/b19-18+/t23-,25+,26+/m1/s1 |
| InChIKey | PONXJIPSRWLMJV-LVJAQAQWSA-N |
| XLogP | 6.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|