C23H32O2Si — CID 11545158
(E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-diphenylpent-4-en-1-ol (PubChem CID 11545158) has the molecular formula C23H32O2Si and a molecular weight of 368.59 g/mol. Its IUPAC name is (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-diphenylpent-4-en-1-ol.
| Compound Name | (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-diphenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 11545158 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,5-diphenylpent-4-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/c1ccccc1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C23H32O2Si/c1-23(2,3)26(4,5)25-22(17-16-19-12-8-6-9-13-19)21(18-24)20-14-10-7-11-15-20/h6-17,21-22,24H,18H2,1-5H3/b17-16+/t21-,22+/m0/s1 |
| InChIKey | UVUVASVVIHXJRV-FYBNUODKSA-N |
| XLogP | 5.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|