C20H31NO5Si — CID 50906502
ethyl (E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-nitro-5-phenylhex-2-enoate (PubChem CID 50906502) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is ethyl (E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-nitro-5-phenylhex-2-enoate.
| Compound Name | ethyl (E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-nitro-5-phenylhex-2-enoate |
|---|---|
| PubChem CID | 50906502 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | ethyl (E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-6-nitro-5-phenylhex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-7-25-19(22)14-13-18(26-27(5,6)20(2,3)4)17(15-21(23)24)16-11-9-8-10-12-16/h8-14,17-18H,7,15H2,1-6H3/b14-13+/t17-,18+/m1/s1 |
| InChIKey | WWQRWDBIKLVKTN-JUWLWVHDSA-N |
| XLogP | 4.56 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|