C25H40O4Si — CID 102455634
ethyl (2E,4E,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyl-9-phenylnona-2,4-dienoate (PubChem CID 102455634) has the molecular formula C25H40O4Si and a molecular weight of 432.68 g/mol. Its IUPAC name is ethyl (2E,4E,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyl-9-phenylnona-2,4-dienoate.
| Compound Name | ethyl (2E,4E,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyl-9-phenylnona-2,4-dienoate |
|---|---|
| PubChem CID | 102455634 |
| Molecular Formula | C25H40O4Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | ethyl (2E,4E,7R,8R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,8-dimethyl-9-phenylnona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/C[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H40O4Si/c1-9-28-23(27)18-16-19(2)15-17-22(26)20(3)24(21-13-11-10-12-14-21)29-30(7,8)25(4,5)6/h10-16,18,20,22,24,26H,9,17H2,1-8H3/b18-16+,19-15+/t20-,22-,24+/m1/s1 |
| InChIKey | BDPVWGQGVCQRKW-UGWPYZJVSA-N |
| XLogP | 6.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|