C23H42O4Si2 — CID 132548533
ethyl 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropanoate (PubChem CID 132548533) has the molecular formula C23H42O4Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is ethyl 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropanoate.
| Compound Name | ethyl 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropanoate |
|---|---|
| PubChem CID | 132548533 |
| Molecular Formula | C23H42O4Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl 2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H42O4Si2/c1-12-25-21(24)20(27-29(10,11)23(5,6)7)19(18-16-14-13-15-17-18)26-28(8,9)22(2,3)4/h13-17,19-20H,12H2,1-11H3 |
| InChIKey | WEPCSWYLYYPQRK-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|